C15H14N2O3 — CID 76906056
3-[3-[(1H-pyrrole-2-carbonylamino)methyl]phenyl]prop-2-enoic acid (PubChem CID 76906056) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is 3-[3-[(1H-pyrrole-2-carbonylamino)methyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[(1H-pyrrole-2-carbonylamino)methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76906056 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 3-[3-[(1H-pyrrole-2-carbonylamino)methyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cccc(CNC(=O)c2ccc[nH]2)c1 |
| InChI | InChI=1S/C15H14N2O3/c18-14(19)7-6-11-3-1-4-12(9-11)10-17-15(20)13-5-2-8-16-13/h1-9,16H,10H2,(H,17,20)(H,18,19) |
| InChIKey | LOZXKGSQQMHBHY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|