C15H16N2O4 — CID 76906010
3-[3-[[(5-oxopyrrolidine-2-carbonyl)amino]methyl]phenyl]prop-2-enoic acid (PubChem CID 76906010) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is 3-[3-[[(5-oxopyrrolidine-2-carbonyl)amino]methyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[[(5-oxopyrrolidine-2-carbonyl)amino]methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76906010 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 3-[3-[[(5-oxopyrrolidine-2-carbonyl)amino]methyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cccc(CNC(=O)C2CCC(=O)N2)c1 |
| InChI | InChI=1S/C15H16N2O4/c18-13-6-5-12(17-13)15(21)16-9-11-3-1-2-10(8-11)4-7-14(19)20/h1-4,7-8,12H,5-6,9H2,(H,16,21)(H,17,18)(H,19,20) |
| InChIKey | XMRYSAZXOUGJTO-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|