C14H14N2O4 — CID 76907392
3-[3-[(5-oxopyrrolidine-2-carbonyl)amino]phenyl]prop-2-enoic acid (PubChem CID 76907392) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 3-[3-[(5-oxopyrrolidine-2-carbonyl)amino]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[(5-oxopyrrolidine-2-carbonyl)amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76907392 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 3-[3-[(5-oxopyrrolidine-2-carbonyl)amino]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cccc(NC(=O)C2CCC(=O)N2)c1 |
| InChI | InChI=1S/C14H14N2O4/c17-12-6-5-11(16-12)14(20)15-10-3-1-2-9(8-10)4-7-13(18)19/h1-4,7-8,11H,5-6H2,(H,15,20)(H,16,17)(H,18,19) |
| InChIKey | HNSDQNZKEWTICJ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|