C35H32N2O6S — CID 137170918
ethyl (5Z)-5-[[4-[(2-cyanophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-4-hydroxy-2-(2-methylbenzoyl)iminothiophene-3-carboxylate (PubChem CID 137170918) has the molecular formula C35H32N2O6S and a molecular weight of 608.72 g/mol. Its IUPAC name is ethyl (5Z)-5-[[4-[(2-cyanophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-4-hydroxy-2-(2-methylbenzoyl)iminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-5-[[4-[(2-cyanophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-4-hydroxy-2-(2-methylbenzoyl)iminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137170918 |
| Molecular Formula | C35H32N2O6S |
| Molecular Weight | 608.72 g/mol |
| Exact Mass | 608.20 |
| IUPAC Name | ethyl (5Z)-5-[[4-[(2-cyanophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-4-hydroxy-2-(2-methylbenzoyl)iminothiophene-3-carboxylate |
| SMILES | C=CCc1cc(/C=C2\S/C(=N\C(=O)c3ccccc3C)C(C(=O)OCC)=C2O)cc(OCC)c1OCc1ccccc1C#N |
| InChI | InChI=1S/C35H32N2O6S/c1-5-12-24-17-23(18-28(41-6-2)32(24)43-21-26-15-10-9-14-25(26)20-36)19-29-31(38)30(35(40)42-7-3)34(44-29)37-33(39)27-16-11-8-13-22(27)4/h5,8-11,13-19,38H,1,6-7,12,21H2,2-4H3/b29-19-,37-34- |
| InChIKey | GURZBNBNHVJPLO-ZLIUZKCWSA-N |
| XLogP | 7.27 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.72 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|