C20H17N3O3 — CID 137174011
7-[2-(5-methoxy-1H-indol-3-yl)ethylideneamino]quinoline-5,8-diol (PubChem CID 137174011) has the molecular formula C20H17N3O3 and a molecular weight of 347.37 g/mol. Its IUPAC name is 7-[2-(5-methoxy-1H-indol-3-yl)ethylideneamino]quinoline-5,8-diol.
| Compound Name | 7-[2-(5-methoxy-1H-indol-3-yl)ethylideneamino]quinoline-5,8-diol |
|---|---|
| PubChem CID | 137174011 |
| Molecular Formula | C20H17N3O3 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 7-[2-(5-methoxy-1H-indol-3-yl)ethylideneamino]quinoline-5,8-diol |
| SMILES | COc1ccc2[nH]cc(C/C=N/c3cc(O)c4cccnc4c3O)c2c1 |
| InChI | InChI=1S/C20H17N3O3/c1-26-13-4-5-16-15(9-13)12(11-23-16)6-8-21-17-10-18(24)14-3-2-7-22-19(14)20(17)25/h2-5,7-11,23-25H,6H2,1H3/b21-8+ |
| InChIKey | YVZVJUSWXNIKGE-ODCIPOBUSA-N |
| XLogP | 4.08 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|