C10H7Cl2N3O2S — CID 137175104
3-[(3,4-dichlorophenyl)methylsulfanyl]-1,4-dihydro-1,2,4-triazine-5,6-dione (PubChem CID 137175104) has the molecular formula C10H7Cl2N3O2S and a molecular weight of 304.16 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)methylsulfanyl]-1,4-dihydro-1,2,4-triazine-5,6-dione.
| Compound Name | 3-[(3,4-dichlorophenyl)methylsulfanyl]-1,4-dihydro-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 137175104 |
| Molecular Formula | C10H7Cl2N3O2S |
| Molecular Weight | 304.16 g/mol |
| Exact Mass | 302.96 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)methylsulfanyl]-1,4-dihydro-1,2,4-triazine-5,6-dione |
| SMILES | O=c1[nH]nc(SCc2ccc(Cl)c(Cl)c2)[nH]c1=O |
| InChI | InChI=1S/C10H7Cl2N3O2S/c11-6-2-1-5(3-7(6)12)4-18-10-13-8(16)9(17)14-15-10/h1-3H,4H2,(H,14,17)(H,13,15,16) |
| InChIKey | FTHVOQLASVBHOL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.16 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|