C10H7Cl2N3OS — CID 135764101
3-[(3,4-dichlorophenyl)methylsulfanyl]-4H-1,2,4-triazin-5-one (PubChem CID 135764101) has the molecular formula C10H7Cl2N3OS and a molecular weight of 288.16 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)methylsulfanyl]-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[(3,4-dichlorophenyl)methylsulfanyl]-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135764101 |
| Molecular Formula | C10H7Cl2N3OS |
| Molecular Weight | 288.16 g/mol |
| Exact Mass | 286.97 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)methylsulfanyl]-4H-1,2,4-triazin-5-one |
| SMILES | O=c1cnnc(SCc2ccc(Cl)c(Cl)c2)[nH]1 |
| InChI | InChI=1S/C10H7Cl2N3OS/c11-7-2-1-6(3-8(7)12)5-17-10-14-9(16)4-13-15-10/h1-4H,5H2,(H,14,15,16) |
| InChIKey | CFRWHJMZZQCDAT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.16 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |