C10H6Cl2FN3OS — CID 168576590
2-[(3,4-dichloro-5-fluorophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 168576590) has the molecular formula C10H6Cl2FN3OS and a molecular weight of 306.15 g/mol. Its IUPAC name is 2-[(3,4-dichloro-5-fluorophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-[(3,4-dichloro-5-fluorophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 168576590 |
| Molecular Formula | C10H6Cl2FN3OS |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 304.96 |
| IUPAC Name | 2-[(3,4-dichloro-5-fluorophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(=NN=Cc2cc(F)c(Cl)c(Cl)c2)N1 |
| InChI | InChI=1S/C10H6Cl2FN3OS/c11-6-1-5(2-7(13)9(6)12)3-14-16-10-15-8(17)4-18-10/h1-3H,4H2,(H,15,16,17) |
| InChIKey | FRCYAJYWTBXEEF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|