C21H22N4O3 — CID 137176168
3,7,7-trimethyl-4-[(E)-2-(4-nitrophenyl)ethenyl]-4,6,8,9-tetrahydro-2H-pyrazolo[3,4-b]quinolin-5-one (PubChem CID 137176168) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is 3,7,7-trimethyl-4-[(E)-2-(4-nitrophenyl)ethenyl]-4,6,8,9-tetrahydro-2H-pyrazolo[3,4-b]quinolin-5-one.
| Compound Name | 3,7,7-trimethyl-4-[(E)-2-(4-nitrophenyl)ethenyl]-4,6,8,9-tetrahydro-2H-pyrazolo[3,4-b]quinolin-5-one |
|---|---|
| PubChem CID | 137176168 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 3,7,7-trimethyl-4-[(E)-2-(4-nitrophenyl)ethenyl]-4,6,8,9-tetrahydro-2H-pyrazolo[3,4-b]quinolin-5-one |
| SMILES | Cc1[nH]nc2c1C(/C=C/c1ccc([N+](=O)[O-])cc1)C1=C(CC(C)(C)CC1=O)N2 |
| InChI | InChI=1S/C21H22N4O3/c1-12-18-15(9-6-13-4-7-14(8-5-13)25(27)28)19-16(22-20(18)24-23-12)10-21(2,3)11-17(19)26/h4-9,15H,10-11H2,1-3H3,(H2,22,23,24)/b9-6+ |
| InChIKey | XPCSJFMUIGIBGZ-RMKNXTFCSA-N |
| XLogP | 4.49 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|