C15H18N4O6S — CID 137179786
[2-hydroxy-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]indol-3-yl]iminothiourea (PubChem CID 137179786) has the molecular formula C15H18N4O6S and a molecular weight of 382.40 g/mol. Its IUPAC name is [2-hydroxy-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]indol-3-yl]iminothiourea.
| Compound Name | [2-hydroxy-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]indol-3-yl]iminothiourea |
|---|---|
| PubChem CID | 137179786 |
| Molecular Formula | C15H18N4O6S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | [2-hydroxy-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]indol-3-yl]iminothiourea |
| SMILES | NC(=S)/N=N/c1c(O)n([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c2ccccc12 |
| InChI | InChI=1S/C15H18N4O6S/c16-15(26)18-17-9-6-3-1-2-4-7(6)19(13(9)24)14-12(23)11(22)10(21)8(5-20)25-14/h1-4,8,10-12,14,20-24H,5H2,(H2,16,26)/b18-17+/t8-,10-,11+,12-,14-/m1/s1 |
| InChIKey | BSOCFVMFQHYFAH-NCOKSMLLSA-N |
| XLogP | -0.35 |
| TPSA | 166.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|