C17H21N5O — CID 137181389
(5R)-N-(1-methylindazol-5-yl)spiro[1,2-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-3-imine (PubChem CID 137181389) has the molecular formula C17H21N5O and a molecular weight of 311.39 g/mol. Its IUPAC name is (5R)-N-(1-methylindazol-5-yl)spiro[1,2-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-3-imine.
| Compound Name | (5R)-N-(1-methylindazol-5-yl)spiro[1,2-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-3-imine |
|---|---|
| PubChem CID | 137181389 |
| Molecular Formula | C17H21N5O |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | (5R)-N-(1-methylindazol-5-yl)spiro[1,2-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-3-imine |
| SMILES | Cn1ncc2cc(/N=C3/C[C@@]4(CN5CCC4CC5)ON3)ccc21 |
| InChI | InChI=1S/C17H21N5O/c1-21-15-3-2-14(8-12(15)10-18-21)19-16-9-17(23-20-16)11-22-6-4-13(17)5-7-22/h2-3,8,10,13H,4-7,9,11H2,1H3,(H,19,20)/t17-/m0/s1 |
| InChIKey | FRGSSSVYDPHZMI-KRWDZBQOSA-N |
| XLogP | 1.99 |
| TPSA | 54.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|