About 5-acetyl-3-ethoxycarbonyl-1-(4-methoxyphenyl)-6-oxopyridin-2-olate;triethylazanium
5-acetyl-3-ethoxycarbonyl-1-(4-methoxyphenyl)-6-oxopyridin-2-olate;triethylazanium (PubChem CID 137183787) has the molecular formula C23H32N2O6
and a molecular weight of 432.52 g/mol. Its IUPAC name is 5-acetyl-3-ethoxycarbonyl-1-(4-methoxyphenyl)-6-oxopyridin-2-olate;triethylazanium.
Molecular Properties
| Compound Name | 5-acetyl-3-ethoxycarbonyl-1-(4-methoxyphenyl)-6-oxopyridin-2-olate;triethylazanium |
| PubChem CID | 137183787 |
| Molecular Formula | C23H32N2O6 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 5-acetyl-3-ethoxycarbonyl-1-(4-methoxyphenyl)-6-oxopyridin-2-olate;triethylazanium |
| SMILES | CCOC(=O)c1cc(C(C)=O)c(=O)n(-c2ccc(OC)cc2)c1[O-].CC[NH+](CC)CC |
| InChI | InChI=1S/C17H17NO6.C6H15N/c1-4-24-17(22)14-9-13(10(2)19)15(20)18(16(14)21)11-5-7-12(23-3)8-6-11;1-4-7(5-2)6-3/h5-9,21H,4H2,1-3H3;4-6H2,1-3H3 |
| InChIKey | MGIVNVLMMPUVEK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 102.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-acetyl-3-ethoxycarbonyl-1-(4-methoxyphenyl)-6-oxopyridin-2-olate;triethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyl-3-ethoxycarbonyl-1-(4-methoxyphenyl)-6-oxopyridin-2-olate;triethylazanium?
The IUPAC name of 5-acetyl-3-ethoxycarbonyl-1-(4-methoxyphenyl)-6-oxopyridin-2-olate;triethylazanium (CID 137183787) is 5-acetyl-3-ethoxycarbonyl-1-(4-methoxyphenyl)-6-oxopyridin-2-olate;triethylazanium.
What is the SMILES notation for 5-acetyl-3-ethoxycarbonyl-1-(4-methoxyphenyl)-6-oxopyridin-2-olate;triethylazanium?
The canonical SMILES for 5-acetyl-3-ethoxycarbonyl-1-(4-methoxyphenyl)-6-oxopyridin-2-olate;triethylazanium is CCOC(=O)c1cc(C(C)=O)c(=O)n(-c2ccc(OC)cc2)c1[O-].CC[NH+](CC)CC.
What is the InChIKey of 5-acetyl-3-ethoxycarbonyl-1-(4-methoxyphenyl)-6-oxopyridin-2-olate;triethylazanium?
The InChIKey is MGIVNVLMMPUVEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO6.C6H15N/c1-4-24-17(22)14-9-13(10(2)19)15(20)18(16(14)21)11-5-7-12(23-3)8-6-11;1-4-7(5-2)6-3/h5-9,21H,4H2,1-3H3;4-6H2,1-3H3.
What are the key properties of 5-acetyl-3-ethoxycarbonyl-1-(4-methoxyphenyl)-6-oxopyridin-2-olate;triethylazanium?
5-acetyl-3-ethoxycarbonyl-1-(4-methoxyphenyl)-6-oxopyridin-2-olate;triethylazanium has a molecular weight of 432.52 g/mol, XLogP of 1.23, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-3-ethoxycarbonyl-1-(4-methoxyphenyl)-6-oxopyridin-2-olate;triethylazanium is sourced from PubChem (CID 137183787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).