C23H21NO6 — CID 142416598
ethyl 5-(2-hydroxybenzoyl)-1-[(4-methoxyphenyl)methyl]-2-oxopyridine-3-carboxylate (PubChem CID 142416598) has the molecular formula C23H21NO6 and a molecular weight of 407.42 g/mol. Its IUPAC name is ethyl 5-(2-hydroxybenzoyl)-1-[(4-methoxyphenyl)methyl]-2-oxopyridine-3-carboxylate.
| Compound Name | ethyl 5-(2-hydroxybenzoyl)-1-[(4-methoxyphenyl)methyl]-2-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 142416598 |
| Molecular Formula | C23H21NO6 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | ethyl 5-(2-hydroxybenzoyl)-1-[(4-methoxyphenyl)methyl]-2-oxopyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)c2ccccc2O)cn(Cc2ccc(OC)cc2)c1=O |
| InChI | InChI=1S/C23H21NO6/c1-3-30-23(28)19-12-16(21(26)18-6-4-5-7-20(18)25)14-24(22(19)27)13-15-8-10-17(29-2)11-9-15/h4-12,14,25H,3,13H2,1-2H3 |
| InChIKey | AMZKRLQZRDBDDQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |