C15H15F3N2O3 — CID 162684166
ethyl 1-[(4-methoxyphenyl)methyl]-2-(trifluoromethyl)imidazole-4-carboxylate (PubChem CID 162684166) has the molecular formula C15H15F3N2O3 and a molecular weight of 328.29 g/mol. Its IUPAC name is ethyl 1-[(4-methoxyphenyl)methyl]-2-(trifluoromethyl)imidazole-4-carboxylate.
| Compound Name | ethyl 1-[(4-methoxyphenyl)methyl]-2-(trifluoromethyl)imidazole-4-carboxylate |
|---|---|
| PubChem CID | 162684166 |
| Molecular Formula | C15H15F3N2O3 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | ethyl 1-[(4-methoxyphenyl)methyl]-2-(trifluoromethyl)imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(Cc2ccc(OC)cc2)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C15H15F3N2O3/c1-3-23-13(21)12-9-20(14(19-12)15(16,17)18)8-10-4-6-11(22-2)7-5-10/h4-7,9H,3,8H2,1-2H3 |
| InChIKey | PZPZKPQHSBDVRM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |