C19H21ClN2O6 — CID 102289828
diethyl 2-[6-chloro-4-[(4-methoxyphenyl)methyl]-3-oxopyrazin-2-yl]propanedioate (PubChem CID 102289828) has the molecular formula C19H21ClN2O6 and a molecular weight of 408.84 g/mol. Its IUPAC name is diethyl 2-[6-chloro-4-[(4-methoxyphenyl)methyl]-3-oxopyrazin-2-yl]propanedioate.
| Compound Name | diethyl 2-[6-chloro-4-[(4-methoxyphenyl)methyl]-3-oxopyrazin-2-yl]propanedioate |
|---|---|
| PubChem CID | 102289828 |
| Molecular Formula | C19H21ClN2O6 |
| Molecular Weight | 408.84 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | diethyl 2-[6-chloro-4-[(4-methoxyphenyl)methyl]-3-oxopyrazin-2-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)c1nc(Cl)cn(Cc2ccc(OC)cc2)c1=O |
| InChI | InChI=1S/C19H21ClN2O6/c1-4-27-18(24)15(19(25)28-5-2)16-17(23)22(11-14(20)21-16)10-12-6-8-13(26-3)9-7-12/h6-9,11,15H,4-5,10H2,1-3H3 |
| InChIKey | LYPTXSSSTJQKCG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 96.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.84 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|