C22H20N2O5 — CID 142747669
ethyl 5-(2-hydroxybenzoyl)-2-(3-methoxyanilino)pyridine-3-carboxylate (PubChem CID 142747669) has the molecular formula C22H20N2O5 and a molecular weight of 392.41 g/mol. Its IUPAC name is ethyl 5-(2-hydroxybenzoyl)-2-(3-methoxyanilino)pyridine-3-carboxylate.
| Compound Name | ethyl 5-(2-hydroxybenzoyl)-2-(3-methoxyanilino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 142747669 |
| Molecular Formula | C22H20N2O5 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | ethyl 5-(2-hydroxybenzoyl)-2-(3-methoxyanilino)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)c2ccccc2O)cnc1Nc1cccc(OC)c1 |
| InChI | InChI=1S/C22H20N2O5/c1-3-29-22(27)18-11-14(20(26)17-9-4-5-10-19(17)25)13-23-21(18)24-15-7-6-8-16(12-15)28-2/h4-13,25H,3H2,1-2H3,(H,23,24) |
| InChIKey | JKSCRZOIZBEUHU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |