C22H20N2O5 — CID 142747686
2-methoxyethyl 2-anilino-5-(2-hydroxybenzoyl)pyridine-3-carboxylate (PubChem CID 142747686) has the molecular formula C22H20N2O5 and a molecular weight of 392.41 g/mol. Its IUPAC name is 2-methoxyethyl 2-anilino-5-(2-hydroxybenzoyl)pyridine-3-carboxylate.
| Compound Name | 2-methoxyethyl 2-anilino-5-(2-hydroxybenzoyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 142747686 |
| Molecular Formula | C22H20N2O5 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 2-methoxyethyl 2-anilino-5-(2-hydroxybenzoyl)pyridine-3-carboxylate |
| SMILES | COCCOC(=O)c1cc(C(=O)c2ccccc2O)cnc1Nc1ccccc1 |
| InChI | InChI=1S/C22H20N2O5/c1-28-11-12-29-22(27)18-13-15(20(26)17-9-5-6-10-19(17)25)14-23-21(18)24-16-7-3-2-4-8-16/h2-10,13-14,25H,11-12H2,1H3,(H,23,24) |
| InChIKey | OSOORMXXZCAPJX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|