C17H17N3O3S — CID 21012399
2-methoxyethyl 4-anilino-5-methylthieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 21012399) has the molecular formula C17H17N3O3S and a molecular weight of 343.41 g/mol. Its IUPAC name is 2-methoxyethyl 4-anilino-5-methylthieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | 2-methoxyethyl 4-anilino-5-methylthieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 21012399 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 2-methoxyethyl 4-anilino-5-methylthieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | COCCOC(=O)c1sc2ncnc(Nc3ccccc3)c2c1C |
| InChI | InChI=1S/C17H17N3O3S/c1-11-13-15(20-12-6-4-3-5-7-12)18-10-19-16(13)24-14(11)17(21)23-9-8-22-2/h3-7,10H,8-9H2,1-2H3,(H,18,19,20) |
| InChIKey | KTXQTAMAYDQZTD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|