C18H17N3O5S — CID 21010040
2-methoxyethyl 4-(1,3-benzodioxol-5-ylamino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 21010040) has the molecular formula C18H17N3O5S and a molecular weight of 387.42 g/mol. Its IUPAC name is 2-methoxyethyl 4-(1,3-benzodioxol-5-ylamino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | 2-methoxyethyl 4-(1,3-benzodioxol-5-ylamino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 21010040 |
| Molecular Formula | C18H17N3O5S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 2-methoxyethyl 4-(1,3-benzodioxol-5-ylamino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | COCCOC(=O)c1sc2ncnc(Nc3ccc4c(c3)OCO4)c2c1C |
| InChI | InChI=1S/C18H17N3O5S/c1-10-14-16(21-11-3-4-12-13(7-11)26-9-25-12)19-8-20-17(14)27-15(10)18(22)24-6-5-23-2/h3-4,7-8H,5-6,9H2,1-2H3,(H,19,20,21) |
| InChIKey | KWXBROUEVSKZJN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|