C19H21N3O5S — CID 21012054
2-methoxyethyl 4-(3,4-dimethoxyanilino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 21012054) has the molecular formula C19H21N3O5S and a molecular weight of 403.46 g/mol. Its IUPAC name is 2-methoxyethyl 4-(3,4-dimethoxyanilino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | 2-methoxyethyl 4-(3,4-dimethoxyanilino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 21012054 |
| Molecular Formula | C19H21N3O5S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 2-methoxyethyl 4-(3,4-dimethoxyanilino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | COCCOC(=O)c1sc2ncnc(Nc3ccc(OC)c(OC)c3)c2c1C |
| InChI | InChI=1S/C19H21N3O5S/c1-11-15-17(22-12-5-6-13(25-3)14(9-12)26-4)20-10-21-18(15)28-16(11)19(23)27-8-7-24-2/h5-6,9-10H,7-8H2,1-4H3,(H,20,21,22) |
| InChIKey | JKDQGWMYRZICSO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|