C16H20ClFN3O4P — CID 137186012
[4-[[[(Z)-2-amino-4-chloro-4-iminobut-2-enoyl]-(cyclobutylmethyl)amino]methyl]-3-fluorophenyl] dihydrogen phosphite (PubChem CID 137186012) has the molecular formula C16H20ClFN3O4P and a molecular weight of 403.78 g/mol. Its IUPAC name is [4-[[[(Z)-2-amino-4-chloro-4-iminobut-2-enoyl]-(cyclobutylmethyl)amino]methyl]-3-fluorophenyl] dihydrogen phosphite.
| Compound Name | [4-[[[(Z)-2-amino-4-chloro-4-iminobut-2-enoyl]-(cyclobutylmethyl)amino]methyl]-3-fluorophenyl] dihydrogen phosphite |
|---|---|
| PubChem CID | 137186012 |
| Molecular Formula | C16H20ClFN3O4P |
| Molecular Weight | 403.78 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | [4-[[[(Z)-2-amino-4-chloro-4-iminobut-2-enoyl]-(cyclobutylmethyl)amino]methyl]-3-fluorophenyl] dihydrogen phosphite |
| SMILES | [H]/N=C(Cl)/C=C(\N)C(=O)N(Cc1ccc(OP(O)O)cc1F)CC1CCC1 |
| InChI | InChI=1S/C16H20ClFN3O4P/c17-15(20)7-14(19)16(22)21(8-10-2-1-3-10)9-11-4-5-12(6-13(11)18)25-26(23)24/h4-7,10,20,23-24H,1-3,8-9,19H2/b14-7-,20-15- |
| InChIKey | SGMDHUFNSPCOEC-JXEPZIMRSA-N |
| XLogP | 2.60 |
| TPSA | 119.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.78 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|