C17H13BrN5O4S+ — CID 137188612
(6S)-10-bromo-6-(4-hydroxy-3-nitrophenyl)-3-methylsulfanyl-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 137188612) has the molecular formula C17H13BrN5O4S+ and a molecular weight of 463.29 g/mol. Its IUPAC name is (6S)-10-bromo-6-(4-hydroxy-3-nitrophenyl)-3-methylsulfanyl-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | (6S)-10-bromo-6-(4-hydroxy-3-nitrophenyl)-3-methylsulfanyl-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 137188612 |
| Molecular Formula | C17H13BrN5O4S+ |
| Molecular Weight | 463.29 g/mol |
| Exact Mass | 461.99 |
| IUPAC Name | (6S)-10-bromo-6-(4-hydroxy-3-nitrophenyl)-3-methylsulfanyl-6,7-dihydro-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | CSc1n[n+]2c(c(=O)[nH]1)-c1cc(Br)ccc1N[C@@H]2c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H12BrN5O4S/c1-28-17-20-16(25)14-10-7-9(18)3-4-11(10)19-15(22(14)21-17)8-2-5-13(24)12(6-8)23(26)27/h2-7,15H,1H3,(H2,20,21,24,25)/p+1/t15-/m0/s1 |
| InChIKey | IYASRZLOAAQIAV-HNNXBMFYSA-O |
| XLogP | 2.80 |
| TPSA | 125.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|