C21H20N5O2S+ — CID 137189467
(6R)-7-propanoyl-3-prop-2-enylsulfanyl-6-pyridin-2-yl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 137189467) has the molecular formula C21H20N5O2S+ and a molecular weight of 406.49 g/mol. Its IUPAC name is (6R)-7-propanoyl-3-prop-2-enylsulfanyl-6-pyridin-2-yl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | (6R)-7-propanoyl-3-prop-2-enylsulfanyl-6-pyridin-2-yl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 137189467 |
| Molecular Formula | C21H20N5O2S+ |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | (6R)-7-propanoyl-3-prop-2-enylsulfanyl-6-pyridin-2-yl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | C=CCSc1n[n+]2c(c(=O)[nH]1)-c1ccccc1N(C(=O)CC)[C@H]2c1ccccn1 |
| InChI | InChI=1S/C21H19N5O2S/c1-3-13-29-21-23-19(28)18-14-9-5-6-11-16(14)25(17(27)4-2)20(26(18)24-21)15-10-7-8-12-22-15/h3,5-12,20H,1,4,13H2,2H3/p+1/t20-/m1/s1 |
| InChIKey | WFBLIKBMCWZDKJ-HXUWFJFHSA-O |
| XLogP | 2.70 |
| TPSA | 82.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|