C19H17N4O2S2+ — CID 137189137
(6S)-7-acetyl-3-prop-2-enylsulfanyl-6-thiophen-2-yl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 137189137) has the molecular formula C19H17N4O2S2+ and a molecular weight of 397.51 g/mol. Its IUPAC name is (6S)-7-acetyl-3-prop-2-enylsulfanyl-6-thiophen-2-yl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | (6S)-7-acetyl-3-prop-2-enylsulfanyl-6-thiophen-2-yl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 137189137 |
| Molecular Formula | C19H17N4O2S2+ |
| Molecular Weight | 397.51 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | (6S)-7-acetyl-3-prop-2-enylsulfanyl-6-thiophen-2-yl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | C=CCSc1n[n+]2c(c(=O)[nH]1)-c1ccccc1N(C(C)=O)[C@@H]2c1cccs1 |
| InChI | InChI=1S/C19H16N4O2S2/c1-3-10-27-19-20-17(25)16-13-7-4-5-8-14(13)22(12(2)24)18(23(16)21-19)15-9-6-11-26-15/h3-9,11,18H,1,10H2,2H3/p+1/t18-/m0/s1 |
| InChIKey | QNWHSQBZZRSLCY-SFHVURJKSA-O |
| XLogP | 2.98 |
| TPSA | 69.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|