C24H18N2O5 — CID 137189789
N-[(E)-(2-hydroxy-4-methoxyphenyl)methylideneamino]-4-(4-oxochromen-2-yl)benzamide (PubChem CID 137189789) has the molecular formula C24H18N2O5 and a molecular weight of 414.42 g/mol. Its IUPAC name is N-[(E)-(2-hydroxy-4-methoxyphenyl)methylideneamino]-4-(4-oxochromen-2-yl)benzamide.
| Compound Name | N-[(E)-(2-hydroxy-4-methoxyphenyl)methylideneamino]-4-(4-oxochromen-2-yl)benzamide |
|---|---|
| PubChem CID | 137189789 |
| Molecular Formula | C24H18N2O5 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | N-[(E)-(2-hydroxy-4-methoxyphenyl)methylideneamino]-4-(4-oxochromen-2-yl)benzamide |
| SMILES | COc1ccc(/C=N/NC(=O)c2ccc(-c3cc(=O)c4ccccc4o3)cc2)c(O)c1 |
| InChI | InChI=1S/C24H18N2O5/c1-30-18-11-10-17(20(27)12-18)14-25-26-24(29)16-8-6-15(7-9-16)23-13-21(28)19-4-2-3-5-22(19)31-23/h2-14,27H,1H3,(H,26,29)/b25-14+ |
| InChIKey | STTPRWOAXTXQQN-AFUMVMLFSA-N |
| XLogP | 3.94 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|