C26H26N2O2 — CID 137189864
8,12-dimethyl-4-(4-methylpent-3-enyl)-10-phenyldiazenyl-2-oxatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),6,8,10-hexaen-11-ol (PubChem CID 137189864) has the molecular formula C26H26N2O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 8,12-dimethyl-4-(4-methylpent-3-enyl)-10-phenyldiazenyl-2-oxatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),6,8,10-hexaen-11-ol.
| Compound Name | 8,12-dimethyl-4-(4-methylpent-3-enyl)-10-phenyldiazenyl-2-oxatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),6,8,10-hexaen-11-ol |
|---|---|
| PubChem CID | 137189864 |
| Molecular Formula | C26H26N2O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 8,12-dimethyl-4-(4-methylpent-3-enyl)-10-phenyldiazenyl-2-oxatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),6,8,10-hexaen-11-ol |
| SMILES | CC(C)=CCCC1=COc2c(C)c(O)c(/N=N/c3ccccc3)c3c(C)ccc1c23 |
| InChI | InChI=1S/C26H26N2O2/c1-16(2)9-8-10-19-15-30-26-18(4)25(29)24(28-27-20-11-6-5-7-12-20)22-17(3)13-14-21(19)23(22)26/h5-7,9,11-15,29H,8,10H2,1-4H3/b28-27+ |
| InChIKey | BTBKPMBIGQALOE-BYYHNAKLSA-N |
| XLogP | 8.06 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|