C19H12N3NaO5 — CID 137191333
sodium (9-carboxy-5-hydroxy-10-methoxybenzo[a]phenazine-6-carbonyl)azanide (PubChem CID 137191333) has the molecular formula C19H12N3NaO5 and a molecular weight of 385.31 g/mol. Its IUPAC name is sodium (9-carboxy-5-hydroxy-10-methoxybenzo[a]phenazine-6-carbonyl)azanide.
| Compound Name | sodium (9-carboxy-5-hydroxy-10-methoxybenzo[a]phenazine-6-carbonyl)azanide |
|---|---|
| PubChem CID | 137191333 |
| Molecular Formula | C19H12N3NaO5 |
| Molecular Weight | 385.31 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | sodium (9-carboxy-5-hydroxy-10-methoxybenzo[a]phenazine-6-carbonyl)azanide |
| SMILES | COc1cc2nc3c(nc2cc1C(=O)O)c(C([NH-])=O)c(O)c1ccccc13.[Na+] |
| InChI | InChI=1S/C19H13N3O5.Na/c1-27-13-7-12-11(6-10(13)19(25)26)22-16-14(18(20)24)17(23)9-5-3-2-4-8(9)15(16)21-12;/h2-7H,1H3,(H4,20,22,23,24,25,26);/q;+1/p-1 |
| InChIKey | BXSWLUTXABDHCK-UHFFFAOYSA-M |
| XLogP | 0.55 |
| TPSA | 133.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.31 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|