C16H20N4O3 — CID 137200016
3-methyl-N-[[1-(6-oxo-1H-pyrimidin-4-yl)piperidin-3-yl]methyl]furan-2-carboxamide (PubChem CID 137200016) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is 3-methyl-N-[[1-(6-oxo-1H-pyrimidin-4-yl)piperidin-3-yl]methyl]furan-2-carboxamide.
| Compound Name | 3-methyl-N-[[1-(6-oxo-1H-pyrimidin-4-yl)piperidin-3-yl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 137200016 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 3-methyl-N-[[1-(6-oxo-1H-pyrimidin-4-yl)piperidin-3-yl]methyl]furan-2-carboxamide |
| SMILES | Cc1ccoc1C(=O)NCC1CCCN(c2cc(=O)[nH]cn2)C1 |
| InChI | InChI=1S/C16H20N4O3/c1-11-4-6-23-15(11)16(22)17-8-12-3-2-5-20(9-12)13-7-14(21)19-10-18-13/h4,6-7,10,12H,2-3,5,8-9H2,1H3,(H,17,22)(H,18,19,21) |
| InChIKey | IKNVLDRDOJJYIU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |