C16H20N4O2 — CID 131952335
3-methyl-N-[(1-pyrazin-2-ylpiperidin-3-yl)methyl]furan-2-carboxamide (PubChem CID 131952335) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 3-methyl-N-[(1-pyrazin-2-ylpiperidin-3-yl)methyl]furan-2-carboxamide.
| Compound Name | 3-methyl-N-[(1-pyrazin-2-ylpiperidin-3-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 131952335 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 3-methyl-N-[(1-pyrazin-2-ylpiperidin-3-yl)methyl]furan-2-carboxamide |
| SMILES | Cc1ccoc1C(=O)NCC1CCCN(c2cnccn2)C1 |
| InChI | InChI=1S/C16H20N4O2/c1-12-4-8-22-15(12)16(21)19-9-13-3-2-7-20(11-13)14-10-17-5-6-18-14/h4-6,8,10,13H,2-3,7,9,11H2,1H3,(H,19,21) |
| InChIKey | WRHUXPSKLNGZBT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |