C10H11N3O — CID 137200434
2-(2-ethylphenyl)-4H-1,2,4-triazol-3-one (PubChem CID 137200434) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is 2-(2-ethylphenyl)-4H-1,2,4-triazol-3-one.
| Compound Name | 2-(2-ethylphenyl)-4H-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 137200434 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 2-(2-ethylphenyl)-4H-1,2,4-triazol-3-one |
| SMILES | CCc1ccccc1-n1nc[nH]c1=O |
| InChI | InChI=1S/C10H11N3O/c1-2-8-5-3-4-6-9(8)13-10(14)11-7-12-13/h3-7H,2H2,1H3,(H,11,12,14) |
| InChIKey | CXHXFQVGQPIDGY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |