C8H7BrN4O — CID 137201161
1-bromo-N'-hydroxyimidazo[1,5-a]pyridine-3-carboximidamide (PubChem CID 137201161) has the molecular formula C8H7BrN4O and a molecular weight of 255.07 g/mol. Its IUPAC name is 1-bromo-N'-hydroxyimidazo[1,5-a]pyridine-3-carboximidamide.
| Compound Name | 1-bromo-N'-hydroxyimidazo[1,5-a]pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 137201161 |
| Molecular Formula | C8H7BrN4O |
| Molecular Weight | 255.07 g/mol |
| Exact Mass | 253.98 |
| IUPAC Name | 1-bromo-N'-hydroxyimidazo[1,5-a]pyridine-3-carboximidamide |
| SMILES | NC(=NO)c1nc(Br)c2ccccn12 |
| InChI | InChI=1S/C8H7BrN4O/c9-6-5-3-1-2-4-13(5)8(11-6)7(10)12-14/h1-4,14H,(H2,10,12) |
| InChIKey | IDZFHLGZDIGPDG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 75.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.07 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|