C16H12BrF3N2O — CID 144805669
(2E)-1-(1-bromoimidazo[1,5-a]pyridin-3-yl)-2-[(E)-1,1,1-trifluorobut-2-en-2-yl]penta-2,4-dien-1-one (PubChem CID 144805669) has the molecular formula C16H12BrF3N2O and a molecular weight of 385.18 g/mol. Its IUPAC name is (2E)-1-(1-bromoimidazo[1,5-a]pyridin-3-yl)-2-[(E)-1,1,1-trifluorobut-2-en-2-yl]penta-2,4-dien-1-one.
| Compound Name | (2E)-1-(1-bromoimidazo[1,5-a]pyridin-3-yl)-2-[(E)-1,1,1-trifluorobut-2-en-2-yl]penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 144805669 |
| Molecular Formula | C16H12BrF3N2O |
| Molecular Weight | 385.18 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | (2E)-1-(1-bromoimidazo[1,5-a]pyridin-3-yl)-2-[(E)-1,1,1-trifluorobut-2-en-2-yl]penta-2,4-dien-1-one |
| SMILES | C=C/C=C(C(=O)c1nc(Br)c2ccccn12)\C(=C/C)C(F)(F)F |
| InChI | InChI=1S/C16H12BrF3N2O/c1-3-7-10(11(4-2)16(18,19)20)13(23)15-21-14(17)12-8-5-6-9-22(12)15/h3-9H,1H2,2H3/b10-7+,11-4+ |
| InChIKey | QXNKUWQSALMJBM-VGZBQUGASA-N |
| XLogP | 4.90 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.18 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|