C13H13N3O4 — CID 137201218
8-hydroxy-2-piperidin-1-yl-3H-quinazoline-4,5,6-trione (PubChem CID 137201218) has the molecular formula C13H13N3O4 and a molecular weight of 275.26 g/mol. Its IUPAC name is 8-hydroxy-2-piperidin-1-yl-3H-quinazoline-4,5,6-trione.
| Compound Name | 8-hydroxy-2-piperidin-1-yl-3H-quinazoline-4,5,6-trione |
|---|---|
| PubChem CID | 137201218 |
| Molecular Formula | C13H13N3O4 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 8-hydroxy-2-piperidin-1-yl-3H-quinazoline-4,5,6-trione |
| SMILES | O=C1C=C(O)c2nc(N3CCCCC3)[nH]c(=O)c2C1=O |
| InChI | InChI=1S/C13H13N3O4/c17-7-6-8(18)11(19)9-10(7)14-13(15-12(9)20)16-4-2-1-3-5-16/h6,17H,1-5H2,(H,14,15,20) |
| InChIKey | PPORLSAVMGZRPG-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|