C18H22N4O3 — CID 137201206
2,8-di(piperidin-1-yl)-3H-quinazoline-4,5,6-trione (PubChem CID 137201206) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 2,8-di(piperidin-1-yl)-3H-quinazoline-4,5,6-trione.
| Compound Name | 2,8-di(piperidin-1-yl)-3H-quinazoline-4,5,6-trione |
|---|---|
| PubChem CID | 137201206 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 2,8-di(piperidin-1-yl)-3H-quinazoline-4,5,6-trione |
| SMILES | O=C1C=C(N2CCCCC2)c2nc(N3CCCCC3)[nH]c(=O)c2C1=O |
| InChI | InChI=1S/C18H22N4O3/c23-13-11-12(21-7-3-1-4-8-21)15-14(16(13)24)17(25)20-18(19-15)22-9-5-2-6-10-22/h11H,1-10H2,(H,19,20,25) |
| InChIKey | MZGDHGFPOAXXOR-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|