C15H16N2O2 — CID 15502953
2-methyl-7-piperidin-1-ylquinoline-5,8-dione (PubChem CID 15502953) has the molecular formula C15H16N2O2 and a molecular weight of 256.30 g/mol. Its IUPAC name is 2-methyl-7-piperidin-1-ylquinoline-5,8-dione.
| Compound Name | 2-methyl-7-piperidin-1-ylquinoline-5,8-dione |
|---|---|
| PubChem CID | 15502953 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-methyl-7-piperidin-1-ylquinoline-5,8-dione |
| SMILES | Cc1ccc2c(n1)C(=O)C(N1CCCCC1)=CC2=O |
| InChI | InChI=1S/C15H16N2O2/c1-10-5-6-11-13(18)9-12(15(19)14(11)16-10)17-7-3-2-4-8-17/h5-6,9H,2-4,7-8H2,1H3 |
| InChIKey | FXJVHVFJFYDHIS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|