C8H7N3S2 — CID 137209864
3-(3-methyl-1,2-thiazol-5-yl)-1H-pyrazine-2-thione (PubChem CID 137209864) has the molecular formula C8H7N3S2 and a molecular weight of 209.30 g/mol. Its IUPAC name is 3-(3-methyl-1,2-thiazol-5-yl)-1H-pyrazine-2-thione.
| Compound Name | 3-(3-methyl-1,2-thiazol-5-yl)-1H-pyrazine-2-thione |
|---|---|
| PubChem CID | 137209864 |
| Molecular Formula | C8H7N3S2 |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.01 |
| IUPAC Name | 3-(3-methyl-1,2-thiazol-5-yl)-1H-pyrazine-2-thione |
| SMILES | Cc1cc(-c2ncc[nH]c2=S)sn1 |
| InChI | InChI=1S/C8H7N3S2/c1-5-4-6(13-11-5)7-8(12)10-3-2-9-7/h2-4H,1H3,(H,10,12) |
| InChIKey | VFPQIYHGQWVWKQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|