C18H22N6O2 — CID 137210970
[1-(5,7,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,11-hexaen-13-yl)piperidin-4-yl] N-propan-2-ylcarbamate (PubChem CID 137210970) has the molecular formula C18H22N6O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is [1-(5,7,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,11-hexaen-13-yl)piperidin-4-yl] N-propan-2-ylcarbamate.
| Compound Name | [1-(5,7,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,11-hexaen-13-yl)piperidin-4-yl] N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 137210970 |
| Molecular Formula | C18H22N6O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | [1-(5,7,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,11-hexaen-13-yl)piperidin-4-yl] N-propan-2-ylcarbamate |
| SMILES | CC(C)NC(=O)OC1CCN(c2nc[nH]c3cnc4nccc4c23)CC1 |
| InChI | InChI=1S/C18H22N6O2/c1-11(2)23-18(25)26-12-4-7-24(8-5-12)17-15-13-3-6-19-16(13)20-9-14(15)21-10-22-17/h3,6,9-12H,4-5,7-8H2,1-2H3,(H,21,22)(H,23,25) |
| InChIKey | FDUSLIZRZDDHDL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |