C19H23N5O3 — CID 137211000
tert-butyl [3-(5,7,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,10-hexaen-13-yl)piperidin-1-yl] carbonate (PubChem CID 137211000) has the molecular formula C19H23N5O3 and a molecular weight of 369.43 g/mol. Its IUPAC name is tert-butyl [3-(5,7,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,10-hexaen-13-yl)piperidin-1-yl] carbonate.
| Compound Name | tert-butyl [3-(5,7,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,10-hexaen-13-yl)piperidin-1-yl] carbonate |
|---|---|
| PubChem CID | 137211000 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | tert-butyl [3-(5,7,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,10-hexaen-13-yl)piperidin-1-yl] carbonate |
| SMILES | CC(C)(C)OC(=O)ON1CCCC(c2[nH]cnc3cnc4nccc4c23)C1 |
| InChI | InChI=1S/C19H23N5O3/c1-19(2,3)26-18(25)27-24-8-4-5-12(10-24)16-15-13-6-7-20-17(13)21-9-14(15)22-11-23-16/h6-7,9,11-12H,4-5,8,10H2,1-3H3,(H,22,23) |
| InChIKey | YQEGKQBLCAHJLM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |