C17H20N6O2 — CID 137210999
[3-(5,7,11,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,10-hexaen-13-yl)piperidin-1-yl] N-ethylcarbamate (PubChem CID 137210999) has the molecular formula C17H20N6O2 and a molecular weight of 340.39 g/mol. Its IUPAC name is [3-(5,7,11,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,10-hexaen-13-yl)piperidin-1-yl] N-ethylcarbamate.
| Compound Name | [3-(5,7,11,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,10-hexaen-13-yl)piperidin-1-yl] N-ethylcarbamate |
|---|---|
| PubChem CID | 137210999 |
| Molecular Formula | C17H20N6O2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | [3-(5,7,11,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,10-hexaen-13-yl)piperidin-1-yl] N-ethylcarbamate |
| SMILES | CCNC(=O)ON1CCCC(c2[nH]ncc3cnc4nccc4c23)C1 |
| InChI | InChI=1S/C17H20N6O2/c1-2-18-17(24)25-23-7-3-4-11(10-23)15-14-12(9-21-22-15)8-20-16-13(14)5-6-19-16/h5-6,8-9,11,22H,2-4,7,10H2,1H3,(H,18,24) |
| InChIKey | QGIBHFHBXLDXSX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |