C17H17F3N6O — CID 136631479
3,3,3-trifluoro-1-[3-(11-methyl-5,7,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,10-hexaen-13-yl)piperidin-1-yl]propan-1-one (PubChem CID 136631479) has the molecular formula C17H17F3N6O and a molecular weight of 378.36 g/mol. Its IUPAC name is 3,3,3-trifluoro-1-[3-(11-methyl-5,7,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,10-hexaen-13-yl)piperidin-1-yl]propan-1-one.
| Compound Name | 3,3,3-trifluoro-1-[3-(11-methyl-5,7,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,10-hexaen-13-yl)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 136631479 |
| Molecular Formula | C17H17F3N6O |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 3,3,3-trifluoro-1-[3-(11-methyl-5,7,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,10-hexaen-13-yl)piperidin-1-yl]propan-1-one |
| SMILES | Cc1nc2nnc3nccc3c2c(C2CCCN(C(=O)CC(F)(F)F)C2)[nH]1 |
| InChI | InChI=1S/C17H17F3N6O/c1-9-22-14(13-11-4-5-21-15(11)24-25-16(13)23-9)10-3-2-6-26(8-10)12(27)7-17(18,19)20/h4-5,10H,2-3,6-8H2,1H3,(H,22,23,25) |
| InChIKey | OMMUFIKTSHAYQT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |