C15H15N7O2S — CID 137024719
1-cyano-N-[1-(5,7,11,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,10-hexaen-13-yl)pyrrolidin-3-yl]methanesulfonamide (PubChem CID 137024719) has the molecular formula C15H15N7O2S and a molecular weight of 357.40 g/mol. Its IUPAC name is 1-cyano-N-[1-(5,7,11,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,10-hexaen-13-yl)pyrrolidin-3-yl]methanesulfonamide.
| Compound Name | 1-cyano-N-[1-(5,7,11,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,10-hexaen-13-yl)pyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 137024719 |
| Molecular Formula | C15H15N7O2S |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 1-cyano-N-[1-(5,7,11,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,10-hexaen-13-yl)pyrrolidin-3-yl]methanesulfonamide |
| SMILES | N#CCS(=O)(=O)NC1CCN(c2[nH]ncc3cnc4nccc4c23)C1 |
| InChI | InChI=1S/C15H15N7O2S/c16-3-6-25(23,24)21-11-2-5-22(9-11)15-13-10(8-19-20-15)7-18-14-12(13)1-4-17-14/h1,4,7-8,11,20-21H,2,5-6,9H2 |
| InChIKey | MKVSPIBEAYAFJH-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 127.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |