C17H19N7O2S — CID 137076863
1-cyano-N-[6-methyl-1-(5,7,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,11-hexaen-13-yl)piperidin-3-yl]methanesulfonamide (PubChem CID 137076863) has the molecular formula C17H19N7O2S and a molecular weight of 385.45 g/mol. Its IUPAC name is 1-cyano-N-[6-methyl-1-(5,7,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,11-hexaen-13-yl)piperidin-3-yl]methanesulfonamide.
| Compound Name | 1-cyano-N-[6-methyl-1-(5,7,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,11-hexaen-13-yl)piperidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 137076863 |
| Molecular Formula | C17H19N7O2S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 1-cyano-N-[6-methyl-1-(5,7,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,11-hexaen-13-yl)piperidin-3-yl]methanesulfonamide |
| SMILES | CC1CCC(NS(=O)(=O)CC#N)CN1c1cn[nH]c2cnc3nccc3c12 |
| InChI | InChI=1S/C17H19N7O2S/c1-11-2-3-12(23-27(25,26)7-5-18)10-24(11)15-9-21-22-14-8-20-17-13(16(14)15)4-6-19-17/h4,6,8-9,11-12,22-23H,2-3,7,10H2,1H3 |
| InChIKey | XJRPWAJNHXDWNY-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 127.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |