C18H20N4O — CID 137211245
N-quinolin-3-ylspiro[1,2-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-3-imine (PubChem CID 137211245) has the molecular formula C18H20N4O and a molecular weight of 308.38 g/mol. Its IUPAC name is N-quinolin-3-ylspiro[1,2-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-3-imine.
| Compound Name | N-quinolin-3-ylspiro[1,2-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-3-imine |
|---|---|
| PubChem CID | 137211245 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | N-quinolin-3-ylspiro[1,2-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-3-imine |
| SMILES | c1ccc2ncc(/N=C3/CC4(CN5CCC4CC5)ON3)cc2c1 |
| InChI | InChI=1S/C18H20N4O/c1-2-4-16-13(3-1)9-15(11-19-16)20-17-10-18(23-21-17)12-22-7-5-14(18)6-8-22/h1-4,9,11,14H,5-8,10,12H2,(H,20,21) |
| InChIKey | VCUYLXWKZFCGMF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|