C16H17ClF3N3O — CID 137211147
N-[3-chloro-4-(trifluoromethyl)phenyl]spiro[1,2-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-3-imine (PubChem CID 137211147) has the molecular formula C16H17ClF3N3O and a molecular weight of 359.78 g/mol. Its IUPAC name is N-[3-chloro-4-(trifluoromethyl)phenyl]spiro[1,2-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-3-imine.
| Compound Name | N-[3-chloro-4-(trifluoromethyl)phenyl]spiro[1,2-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-3-imine |
|---|---|
| PubChem CID | 137211147 |
| Molecular Formula | C16H17ClF3N3O |
| Molecular Weight | 359.78 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | N-[3-chloro-4-(trifluoromethyl)phenyl]spiro[1,2-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-3-imine |
| SMILES | FC(F)(F)c1ccc(/N=C2/CC3(CN4CCC3CC4)ON2)cc1Cl |
| InChI | InChI=1S/C16H17ClF3N3O/c17-13-7-11(1-2-12(13)16(18,19)20)21-14-8-15(24-22-14)9-23-5-3-10(15)4-6-23/h1-2,7,10H,3-6,8-9H2,(H,21,22) |
| InChIKey | DGPCYVWJRQZOGA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.78 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|