C18H19FN4O — CID 137211126
(5R)-N-(6-fluoroisoquinolin-3-yl)spiro[1,2-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-3-imine (PubChem CID 137211126) has the molecular formula C18H19FN4O and a molecular weight of 326.37 g/mol. Its IUPAC name is (5R)-N-(6-fluoroisoquinolin-3-yl)spiro[1,2-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-3-imine.
| Compound Name | (5R)-N-(6-fluoroisoquinolin-3-yl)spiro[1,2-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-3-imine |
|---|---|
| PubChem CID | 137211126 |
| Molecular Formula | C18H19FN4O |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (5R)-N-(6-fluoroisoquinolin-3-yl)spiro[1,2-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-3-imine |
| SMILES | Fc1ccc2cnc(/N=C3/C[C@@]4(CN5CCC4CC5)ON3)cc2c1 |
| InChI | InChI=1S/C18H19FN4O/c19-15-2-1-12-10-20-16(8-13(12)7-15)21-17-9-18(24-22-17)11-23-5-3-14(18)4-6-23/h1-2,7-8,10,14H,3-6,9,11H2,(H,20,21,22)/t18-/m0/s1 |
| InChIKey | HDNWCLXYWXPBRZ-SFHVURJKSA-N |
| XLogP | 2.79 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|