C16H17ClN4OS — CID 137192465
N-(3-chlorothieno[2,3-b]pyridin-6-yl)spiro[1,2-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-3-imine (PubChem CID 137192465) has the molecular formula C16H17ClN4OS and a molecular weight of 348.86 g/mol. Its IUPAC name is N-(3-chlorothieno[2,3-b]pyridin-6-yl)spiro[1,2-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-3-imine.
| Compound Name | N-(3-chlorothieno[2,3-b]pyridin-6-yl)spiro[1,2-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-3-imine |
|---|---|
| PubChem CID | 137192465 |
| Molecular Formula | C16H17ClN4OS |
| Molecular Weight | 348.86 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | N-(3-chlorothieno[2,3-b]pyridin-6-yl)spiro[1,2-oxazolidine-5,3'-1-azabicyclo[2.2.2]octane]-3-imine |
| SMILES | Clc1csc2nc(/N=C3/CC4(CN5CCC4CC5)ON3)ccc12 |
| InChI | InChI=1S/C16H17ClN4OS/c17-12-8-23-15-11(12)1-2-13(19-15)18-14-7-16(22-20-14)9-21-5-3-10(16)4-6-21/h1-2,8,10H,3-7,9H2,(H,18,19,20) |
| InChIKey | RIXQGNCAGWTPLX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.86 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|