C23H13Cl2FN4 — CID 137212231
7-(2-chloro-4-fluorophenyl)-2-(chloromethyl)-5-(1H-indol-3-yl)imidazo[1,2-a]pyridine-8-carbonitrile (PubChem CID 137212231) has the molecular formula C23H13Cl2FN4 and a molecular weight of 435.29 g/mol. Its IUPAC name is 7-(2-chloro-4-fluorophenyl)-2-(chloromethyl)-5-(1H-indol-3-yl)imidazo[1,2-a]pyridine-8-carbonitrile.
| Compound Name | 7-(2-chloro-4-fluorophenyl)-2-(chloromethyl)-5-(1H-indol-3-yl)imidazo[1,2-a]pyridine-8-carbonitrile |
|---|---|
| PubChem CID | 137212231 |
| Molecular Formula | C23H13Cl2FN4 |
| Molecular Weight | 435.29 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | 7-(2-chloro-4-fluorophenyl)-2-(chloromethyl)-5-(1H-indol-3-yl)imidazo[1,2-a]pyridine-8-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(F)cc2Cl)cc(-c2c[nH]c3ccccc23)n2cc(CCl)nc12 |
| InChI | InChI=1S/C23H13Cl2FN4/c24-9-14-12-30-22(19-11-28-21-4-2-1-3-16(19)21)8-17(18(10-27)23(30)29-14)15-6-5-13(26)7-20(15)25/h1-8,11-12,28H,9H2 |
| InChIKey | DSVIBINAOADEFC-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 56.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.29 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|