About azane;(Z)-hydroxy-hydroxyimino-phenylazanium
azane;(Z)-hydroxy-hydroxyimino-phenylazanium (PubChem CID 137214743) has the molecular formula C6H10N3O2+
and a molecular weight of 156.16 g/mol. Its IUPAC name is azane;(Z)-hydroxy-hydroxyimino-phenylazanium.
Molecular Properties
| Compound Name | azane;(Z)-hydroxy-hydroxyimino-phenylazanium |
| PubChem CID | 137214743 |
| Molecular Formula | C6H10N3O2+ |
| Molecular Weight | 156.16 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | azane;(Z)-hydroxy-hydroxyimino-phenylazanium |
| SMILES | N.O/N=[N+](\O)c1ccccc1 |
| InChI | InChI=1S/C6H6N2O2.H3N/c9-7-8(10)6-4-2-1-3-5-6;/h1-5,10H;1H3/p+1 |
| InChIKey | NJVHCUNZAMFQNA-UHFFFAOYSA-O |
| XLogP | 1.72 |
| TPSA | 90.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.16 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze azane;(Z)-hydroxy-hydroxyimino-phenylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;(Z)-hydroxy-hydroxyimino-phenylazanium?
The IUPAC name of azane;(Z)-hydroxy-hydroxyimino-phenylazanium (CID 137214743) is azane;(Z)-hydroxy-hydroxyimino-phenylazanium.
What is the SMILES notation for azane;(Z)-hydroxy-hydroxyimino-phenylazanium?
The canonical SMILES for azane;(Z)-hydroxy-hydroxyimino-phenylazanium is N.O/N=[N+](\O)c1ccccc1.
What is the InChIKey of azane;(Z)-hydroxy-hydroxyimino-phenylazanium?
The InChIKey is NJVHCUNZAMFQNA-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H6N2O2.H3N/c9-7-8(10)6-4-2-1-3-5-6;/h1-5,10H;1H3/p+1.
What are the key properties of azane;(Z)-hydroxy-hydroxyimino-phenylazanium?
azane;(Z)-hydroxy-hydroxyimino-phenylazanium has a molecular weight of 156.16 g/mol, XLogP of 1.72, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;(Z)-hydroxy-hydroxyimino-phenylazanium is sourced from PubChem (CID 137214743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).