About diphenyldiazene
diphenyldiazene (PubChem CID 2272) has the molecular formula C12H10N2
and a molecular weight of 182.23 g/mol. Its IUPAC name is diphenyldiazene.
Molecular Properties
| Compound Name | diphenyldiazene |
| PubChem CID | 2272 |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | diphenyldiazene |
| SMILES | c1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10N2/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12/h1-10H/b14-13+ |
| InChIKey | DMLAVOWQYNRWNQ-BUHFOSPRSA-N |
| XLogP | 4.10 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze diphenyldiazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyldiazene?
The IUPAC name of diphenyldiazene (CID 2272) is diphenyldiazene.
What is the SMILES notation for diphenyldiazene?
The canonical SMILES for diphenyldiazene is c1ccc(/N=N/c2ccccc2)cc1.
What is the InChIKey of diphenyldiazene?
The InChIKey is DMLAVOWQYNRWNQ-BUHFOSPRSA-N. The full InChI is InChI=1S/C12H10N2/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12/h1-10H/b14-13+.
What are the key properties of diphenyldiazene?
diphenyldiazene has a molecular weight of 182.23 g/mol, XLogP of 4.10, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyldiazene is sourced from PubChem (CID 2272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).