C33H37N5O4 — CID 137215848
2-hydroxy-1,5-dimethyl-3-[N-[4-[3-(4-methylpiperazin-1-yl)propylcarbamoyl]phenyl]-C-phenylcarbonimidoyl]indole-6-carboxylic acid (PubChem CID 137215848) has the molecular formula C33H37N5O4 and a molecular weight of 567.69 g/mol. Its IUPAC name is 2-hydroxy-1,5-dimethyl-3-[N-[4-[3-(4-methylpiperazin-1-yl)propylcarbamoyl]phenyl]-C-phenylcarbonimidoyl]indole-6-carboxylic acid.
| Compound Name | 2-hydroxy-1,5-dimethyl-3-[N-[4-[3-(4-methylpiperazin-1-yl)propylcarbamoyl]phenyl]-C-phenylcarbonimidoyl]indole-6-carboxylic acid |
|---|---|
| PubChem CID | 137215848 |
| Molecular Formula | C33H37N5O4 |
| Molecular Weight | 567.69 g/mol |
| Exact Mass | 567.28 |
| IUPAC Name | 2-hydroxy-1,5-dimethyl-3-[N-[4-[3-(4-methylpiperazin-1-yl)propylcarbamoyl]phenyl]-C-phenylcarbonimidoyl]indole-6-carboxylic acid |
| SMILES | Cc1cc2c(/C(=N/c3ccc(C(=O)NCCCN4CCN(C)CC4)cc3)c3ccccc3)c(O)n(C)c2cc1C(=O)O |
| InChI | InChI=1S/C33H37N5O4/c1-22-20-27-28(21-26(22)33(41)42)37(3)32(40)29(27)30(23-8-5-4-6-9-23)35-25-12-10-24(11-13-25)31(39)34-14-7-15-38-18-16-36(2)17-19-38/h4-6,8-13,20-21,40H,7,14-19H2,1-3H3,(H,34,39)(H,41,42)/b35-30+ |
| InChIKey | WBRFEERWLXMPSD-WUZYOQQESA-N |
| XLogP | 4.43 |
| TPSA | 110.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.69 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|